C19H20FN7O2 — CID 135500082
4-[(E)-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 135500082) has the molecular formula C19H20FN7O2 and a molecular weight of 397.41 g/mol. Its IUPAC name is 4-[(E)-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135500082 |
| Molecular Formula | C19H20FN7O2 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 4-[(E)-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N/Nc2nc(Nc3ccc(F)cc3)nc(N(C)C)n2)ccc1O |
| InChI | InChI=1S/C19H20FN7O2/c1-27(2)19-24-17(22-14-7-5-13(20)6-8-14)23-18(25-19)26-21-11-12-4-9-15(28)16(10-12)29-3/h4-11,28H,1-3H3,(H2,22,23,24,25,26)/b21-11+ |
| InChIKey | PWXUGSUWJKXQEJ-SRZZPIQSSA-N |
| XLogP | 2.98 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|