C21H19FN2O5S — CID 135500589
2-[2-ethoxy-4-[[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 135500589) has the molecular formula C21H19FN2O5S and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[2-ethoxy-4-[[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 135500589 |
| Molecular Formula | C21H19FN2O5S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-[2-ethoxy-4-[[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | CCOc1cc(C=C2S/C(=N/c3ccc(F)cc3)NC2=O)ccc1OC(C)C(=O)O |
| InChI | InChI=1S/C21H19FN2O5S/c1-3-28-17-10-13(4-9-16(17)29-12(2)20(26)27)11-18-19(25)24-21(30-18)23-15-7-5-14(22)6-8-15/h4-12H,3H2,1-2H3,(H,26,27)(H,23,24,25) |
| InChIKey | YQPVNYZUIOCCLF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|