C14H14N4OS — CID 135500631
1-phenyl-6-propan-2-ylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135500631) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is 1-phenyl-6-propan-2-ylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-phenyl-6-propan-2-ylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135500631 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1-phenyl-6-propan-2-ylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC(C)Sc1nc2c(cnn2-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H14N4OS/c1-9(2)20-14-16-12-11(13(19)17-14)8-15-18(12)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,16,17,19) |
| InChIKey | XVELRVLAUSXTAA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |