About 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one
2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one (PubChem CID 135500927) has the molecular formula C17H21N3O
and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one.
Molecular Properties
| Compound Name | 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one |
| PubChem CID | 135500927 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one |
| SMILES | CN(C)Cc1nc2c(c(=O)[nH]1)C(C)(C)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H21N3O/c1-17(2)9-11-7-5-6-8-12(11)15-14(17)16(21)19-13(18-15)10-20(3)4/h5-8H,9-10H2,1-4H3,(H,18,19,21) |
| InChIKey | RQWIYCGKKVRFPI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one?
The IUPAC name of 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one (CID 135500927) is 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one.
What is the SMILES notation for 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one?
The canonical SMILES for 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one is CN(C)Cc1nc2c(c(=O)[nH]1)C(C)(C)Cc1ccccc1-2.
What is the InChIKey of 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one?
The InChIKey is RQWIYCGKKVRFPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O/c1-17(2)9-11-7-5-6-8-12(11)15-14(17)16(21)19-13(18-15)10-20(3)4/h5-8H,9-10H2,1-4H3,(H,18,19,21).
What are the key properties of 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one?
2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one has a molecular weight of 283.38 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(dimethylamino)methyl]-5,5-dimethyl-3,6-dihydrobenzo[h]quinazolin-4-one is sourced from PubChem (CID 135500927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).