C15H14F3N5O — CID 135500932
2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine (PubChem CID 135500932) has the molecular formula C15H14F3N5O and a molecular weight of 337.31 g/mol. Its IUPAC name is 2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 135500932 |
| Molecular Formula | C15H14F3N5O |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine |
| SMILES | N/C(=N\c1nc2c(c(=O)[nH]1)CCC2)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H14F3N5O/c16-15(17,18)9-5-1-2-6-11(9)20-13(19)23-14-21-10-7-3-4-8(10)12(24)22-14/h1-2,5-6H,3-4,7H2,(H4,19,20,21,22,23,24) |
| InChIKey | XFKHVPWQAXWFGS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|