C18H24N4O10 — CID 135501082
[(3S,4S,5R)-6-[acetyl-(4-amino-2-methoxy-6-oxo-1H-pyrimidin-5-yl)amino]-4,5-diacetyloxyoxan-3-yl] acetate (PubChem CID 135501082) has the molecular formula C18H24N4O10 and a molecular weight of 456.41 g/mol. Its IUPAC name is [(3S,4S,5R)-6-[acetyl-(4-amino-2-methoxy-6-oxo-1H-pyrimidin-5-yl)amino]-4,5-diacetyloxyoxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R)-6-[acetyl-(4-amino-2-methoxy-6-oxo-1H-pyrimidin-5-yl)amino]-4,5-diacetyloxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 135501082 |
| Molecular Formula | C18H24N4O10 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [(3S,4S,5R)-6-[acetyl-(4-amino-2-methoxy-6-oxo-1H-pyrimidin-5-yl)amino]-4,5-diacetyloxyoxan-3-yl] acetate |
| SMILES | COc1nc(N)c(N(C(C)=O)C2OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(=O)[nH]1 |
| InChI | InChI=1S/C18H24N4O10/c1-7(23)22(12-15(19)20-18(28-5)21-16(12)27)17-14(32-10(4)26)13(31-9(3)25)11(6-29-17)30-8(2)24/h11,13-14,17H,6H2,1-5H3,(H3,19,20,21,27)/t11-,13-,14+,17?/m0/s1 |
| InChIKey | PATOHJLQTLRFSY-DEJFJOPASA-N |
| XLogP | -1.13 |
| TPSA | 189.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|