C33H35N5O9 — CID 135501213
(2R)-2-[[(4S)-4-carboxy-4-[[4-[(2-methyl-4-oxo-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-6-yl)-prop-2-ynylamino]benzoyl]amino]butanoyl]-methylamino]pentanedioic acid (PubChem CID 135501213) has the molecular formula C33H35N5O9 and a molecular weight of 645.67 g/mol. Its IUPAC name is (2R)-2-[[(4S)-4-carboxy-4-[[4-[(2-methyl-4-oxo-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-6-yl)-prop-2-ynylamino]benzoyl]amino]butanoyl]-methylamino]pentanedioic acid.
| Compound Name | (2R)-2-[[(4S)-4-carboxy-4-[[4-[(2-methyl-4-oxo-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-6-yl)-prop-2-ynylamino]benzoyl]amino]butanoyl]-methylamino]pentanedioic acid |
|---|---|
| PubChem CID | 135501213 |
| Molecular Formula | C33H35N5O9 |
| Molecular Weight | 645.67 g/mol |
| Exact Mass | 645.24 |
| IUPAC Name | (2R)-2-[[(4S)-4-carboxy-4-[[4-[(2-methyl-4-oxo-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-6-yl)-prop-2-ynylamino]benzoyl]amino]butanoyl]-methylamino]pentanedioic acid |
| SMILES | C#CCN(c1ccc(C(=O)N[C@@H](CCC(=O)N(C)[C@H](CCC(=O)O)C(=O)O)C(=O)O)cc1)C1CCc2cc3nc(C)[nH]c(=O)c3cc21 |
| InChI | InChI=1S/C33H35N5O9/c1-4-15-38(26-11-7-20-16-25-23(17-22(20)26)31(43)35-18(2)34-25)21-8-5-19(6-9-21)30(42)36-24(32(44)45)10-13-28(39)37(3)27(33(46)47)12-14-29(40)41/h1,5-6,8-9,16-17,24,26-27H,7,10-15H2,2-3H3,(H,36,42)(H,40,41)(H,44,45)(H,46,47)(H,34,35,43)/t24-,26?,27+/m0/s1 |
| InChIKey | GIMQSJOVQUNSIH-MUXGKCGLSA-N |
| XLogP | 2.10 |
| TPSA | 210.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.67 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|