C12H9N3O6 — CID 135501359
2-[(Z)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one (PubChem CID 135501359) has the molecular formula C12H9N3O6 and a molecular weight of 291.22 g/mol. Its IUPAC name is 2-[(Z)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-[(Z)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135501359 |
| Molecular Formula | C12H9N3O6 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-[(Z)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(/C=C\c2ccc(O)c(O)c2)nc(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9N3O6/c16-7-3-1-6(5-8(7)17)2-4-9-13-11(18)10(15(20)21)12(19)14-9/h1-5,16-17H,(H2,13,14,18,19)/b4-2- |
| InChIKey | MLSWHGPRFDEWHW-RQOWECAXSA-N |
| XLogP | 0.97 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|