About methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate
methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate (PubChem CID 135501615) has the molecular formula C11H8N4O4
and a molecular weight of 260.21 g/mol. Its IUPAC name is methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate |
| PubChem CID | 135501615 |
| Molecular Formula | C11H8N4O4 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate |
| SMILES | COC(=O)Nc1c(C#N)[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C11H8N4O4/c1-19-11(16)13-10-9(6-12)14(17)7-4-2-3-5-8(7)15(10)18/h2-5H,1H3,(H,13,16) |
| InChIKey | RNARHQNKYHCHHE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate?
The IUPAC name of methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate (CID 135501615) is methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate.
What is the SMILES notation for methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate?
The canonical SMILES for methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate is COC(=O)Nc1c(C#N)[n+]([O-])c2ccccc2[n+]1[O-].
What is the InChIKey of methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate?
The InChIKey is RNARHQNKYHCHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O4/c1-19-11(16)13-10-9(6-12)14(17)7-4-2-3-5-8(7)15(10)18/h2-5H,1H3,(H,13,16).
What are the key properties of methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate?
methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate has a molecular weight of 260.21 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)carbamate is sourced from PubChem (CID 135501615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).