C18H13N3O2 — CID 135501757
4-(4-methoxyphenyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 135501757) has the molecular formula C18H13N3O2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-methoxyphenyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135501757 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 4-(4-methoxyphenyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C18H13N3O2/c1-23-14-9-7-12(8-10-14)16-15(11-19)18(22)21-17(20-16)13-5-3-2-4-6-13/h2-10H,1H3,(H,20,21,22) |
| InChIKey | GJOQBJRUWFZOHT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |