C18H15ClN4O — CID 135501782
N-[(E)-(6-chloro-2,3,4,9-tetrahydrocarbazol-1-ylidene)amino]pyridine-4-carboxamide (PubChem CID 135501782) has the molecular formula C18H15ClN4O and a molecular weight of 338.80 g/mol. Its IUPAC name is N-[(E)-(6-chloro-2,3,4,9-tetrahydrocarbazol-1-ylidene)amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(6-chloro-2,3,4,9-tetrahydrocarbazol-1-ylidene)amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135501782 |
| Molecular Formula | C18H15ClN4O |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-[(E)-(6-chloro-2,3,4,9-tetrahydrocarbazol-1-ylidene)amino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C1\CCCc2c1[nH]c1ccc(Cl)cc21)c1ccncc1 |
| InChI | InChI=1S/C18H15ClN4O/c19-12-4-5-15-14(10-12)13-2-1-3-16(17(13)21-15)22-23-18(24)11-6-8-20-9-7-11/h4-10,21H,1-3H2,(H,23,24)/b22-16+ |
| InChIKey | IYHPMSUEMBCZJE-CJLVFECKSA-N |
| XLogP | 3.69 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|