About 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one
2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one (PubChem CID 135501961) has the molecular formula C13H17N3O3
and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one |
| PubChem CID | 135501961 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one |
| SMILES | CCNCc1nc2cc(OC)c(OC)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H17N3O3/c1-4-14-7-12-15-9-6-11(19-3)10(18-2)5-8(9)13(17)16-12/h5-6,14H,4,7H2,1-3H3,(H,15,16,17) |
| InChIKey | SEXRDGFJSQWDRA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one?
The IUPAC name of 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one (CID 135501961) is 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one.
What is the SMILES notation for 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one?
The canonical SMILES for 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one is CCNCc1nc2cc(OC)c(OC)cc2c(=O)[nH]1.
What is the InChIKey of 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one?
The InChIKey is SEXRDGFJSQWDRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3/c1-4-14-7-12-15-9-6-11(19-3)10(18-2)5-8(9)13(17)16-12/h5-6,14H,4,7H2,1-3H3,(H,15,16,17).
What are the key properties of 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one?
2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one has a molecular weight of 263.30 g/mol, XLogP of 1.05, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylaminomethyl)-6,7-dimethoxy-3H-quinazolin-4-one is sourced from PubChem (CID 135501961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).