C18H24N2O2 — CID 135501980
2-methoxy-4-[(E)-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]methyl]phenol (PubChem CID 135501980) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-methoxy-4-[(E)-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]methyl]phenol.
| Compound Name | 2-methoxy-4-[(E)-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135501980 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-methoxy-4-[(E)-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(/C=N/N=C2\CC3CCC2(C)C3(C)C)ccc1O |
| InChI | InChI=1S/C18H24N2O2/c1-17(2)13-7-8-18(17,3)16(10-13)20-19-11-12-5-6-14(21)15(9-12)22-4/h5-6,9,11,13,21H,7-8,10H2,1-4H3/b19-11+,20-16+ |
| InChIKey | FCFUFHMBJWTHIT-WBVBEWOVSA-N |
| XLogP | 4.02 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|