About 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide
2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide (PubChem CID 135501982) has the molecular formula C15H18ClN3O2S
and a molecular weight of 339.85 g/mol. Its IUPAC name is 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide.
Molecular Properties
| Compound Name | 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide |
| PubChem CID | 135501982 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide |
| SMILES | CCCC/N=C1\NC(=O)C(CC(=O)Nc2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-2-3-8-17-15-19-14(21)12(22-15)9-13(20)18-11-6-4-10(16)5-7-11/h4-7,12H,2-3,8-9H2,1H3,(H,18,20)(H,17,19,21) |
| InChIKey | CYGFGYXNJZTYIC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide?
The IUPAC name of 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide (CID 135501982) is 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide.
What is the SMILES notation for 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide?
The canonical SMILES for 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide is CCCC/N=C1\NC(=O)C(CC(=O)Nc2ccc(Cl)cc2)S1.
What is the InChIKey of 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide?
The InChIKey is CYGFGYXNJZTYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3O2S/c1-2-3-8-17-15-19-14(21)12(22-15)9-13(20)18-11-6-4-10(16)5-7-11/h4-7,12H,2-3,8-9H2,1H3,(H,18,20)(H,17,19,21).
What are the key properties of 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide?
2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide has a molecular weight of 339.85 g/mol, XLogP of 3.06, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(4-chlorophenyl)acetamide is sourced from PubChem (CID 135501982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).