C16H21N3O — CID 135502633
3-cyclobutyl-4-cyclohex-3-en-1-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one (PubChem CID 135502633) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-cyclobutyl-4-cyclohex-3-en-1-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one.
| Compound Name | 3-cyclobutyl-4-cyclohex-3-en-1-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135502633 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 3-cyclobutyl-4-cyclohex-3-en-1-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one |
| SMILES | O=C1CC(C2CC=CCC2)c2c(n[nH]c2C2CCC2)N1 |
| InChI | InChI=1S/C16H21N3O/c20-13-9-12(10-5-2-1-3-6-10)14-15(11-7-4-8-11)18-19-16(14)17-13/h1-2,10-12H,3-9H2,(H2,17,18,19,20) |
| InChIKey | UYJJUYVTWYBXFK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|