C23H16N4O — CID 135502687
2-(6,8-diphenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)phenol (PubChem CID 135502687) has the molecular formula C23H16N4O and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-(6,8-diphenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)phenol.
| Compound Name | 2-(6,8-diphenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)phenol |
|---|---|
| PubChem CID | 135502687 |
| Molecular Formula | C23H16N4O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-(6,8-diphenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)phenol |
| SMILES | Oc1ccccc1-c1nnc2c(-c3ccccc3)cc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C23H16N4O/c28-21-14-8-7-13-18(21)22-24-25-23-19(16-9-3-1-4-10-16)15-20(26-27(22)23)17-11-5-2-6-12-17/h1-15,28H |
| InChIKey | SDLWJGYBURGQTO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |