C14H21N5O7S — CID 135502806
2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one;2-(5,6-dihydroxy-1H-indol-3-yl)ethylazanium;sulfate (PubChem CID 135502806) has the molecular formula C14H21N5O7S and a molecular weight of 403.42 g/mol. Its IUPAC name is 2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one;2-(5,6-dihydroxy-1H-indol-3-yl)ethylazanium;sulfate.
| Compound Name | 2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one;2-(5,6-dihydroxy-1H-indol-3-yl)ethylazanium;sulfate |
|---|---|
| PubChem CID | 135502806 |
| Molecular Formula | C14H21N5O7S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one;2-(5,6-dihydroxy-1H-indol-3-yl)ethylazanium;sulfate |
| SMILES | C[N+]1=C(N)NC(=O)C1.O=S(=O)([O-])[O-].[NH3+]CCc1c[nH]c2cc(O)c(O)cc12 |
| InChI | InChI=1S/C10H12N2O2.C4H7N3O.H2O4S/c11-2-1-6-5-12-8-4-10(14)9(13)3-7(6)8;1-7-2-3(8)6-4(7)5;1-5(2,3)4/h3-5,12-14H,1-2,11H2;2H2,1H3,(H2,5,6,8);(H2,1,2,3,4) |
| InChIKey | UGTUOBCWMROLQG-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 222.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|