About (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol
(E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol (PubChem CID 135502922) has the molecular formula C14H14N2O4
and a molecular weight of 274.28 g/mol. Its IUPAC name is (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol.
Molecular Properties
| Compound Name | (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol |
| PubChem CID | 135502922 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol |
| SMILES | COc1ccc(/C(O)=C(\O)c2ccc(OC)cn2)nc1 |
| InChI | InChI=1S/C14H14N2O4/c1-19-9-3-5-11(15-7-9)13(17)14(18)12-6-4-10(20-2)8-16-12/h3-8,17-18H,1-2H3/b14-13+ |
| InChIKey | XKYUWKARMWXYFG-BUHFOSPRSA-N |
| XLogP | 2.44 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol?
The IUPAC name of (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol (CID 135502922) is (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol.
What is the SMILES notation for (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol?
The canonical SMILES for (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol is COc1ccc(/C(O)=C(\O)c2ccc(OC)cn2)nc1.
What is the InChIKey of (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol?
The InChIKey is XKYUWKARMWXYFG-BUHFOSPRSA-N. The full InChI is InChI=1S/C14H14N2O4/c1-19-9-3-5-11(15-7-9)13(17)14(18)12-6-4-10(20-2)8-16-12/h3-8,17-18H,1-2H3/b14-13+.
What are the key properties of (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol?
(E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol has a molecular weight of 274.28 g/mol, XLogP of 2.44, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-bis(5-methoxy-2-pyridinyl)ethene-1,2-diol is sourced from PubChem (CID 135502922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).