C23H20N2O3 — CID 135502974
4-[5-ethyl-1,2-bis(4-hydroxyphenyl)imidazol-4-yl]phenol (PubChem CID 135502974) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-[5-ethyl-1,2-bis(4-hydroxyphenyl)imidazol-4-yl]phenol.
| Compound Name | 4-[5-ethyl-1,2-bis(4-hydroxyphenyl)imidazol-4-yl]phenol |
|---|---|
| PubChem CID | 135502974 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-[5-ethyl-1,2-bis(4-hydroxyphenyl)imidazol-4-yl]phenol |
| SMILES | CCc1c(-c2ccc(O)cc2)nc(-c2ccc(O)cc2)n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C23H20N2O3/c1-2-21-22(15-3-9-18(26)10-4-15)24-23(16-5-11-19(27)12-6-16)25(21)17-7-13-20(28)14-8-17/h3-14,26-28H,2H2,1H3 |
| InChIKey | RSKWAKZVAOZXKI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |