C20H18ClFN4O2 — CID 135503000
5-(2-chlorophenyl)-7-fluoro-8-(2-methoxyethoxy)-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine (PubChem CID 135503000) has the molecular formula C20H18ClFN4O2 and a molecular weight of 400.84 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-fluoro-8-(2-methoxyethoxy)-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine.
| Compound Name | 5-(2-chlorophenyl)-7-fluoro-8-(2-methoxyethoxy)-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine |
|---|---|
| PubChem CID | 135503000 |
| Molecular Formula | C20H18ClFN4O2 |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 5-(2-chlorophenyl)-7-fluoro-8-(2-methoxyethoxy)-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine |
| SMILES | COCCOc1cc2c(cc1F)C(c1ccccc1Cl)=Nc1c(n[nH]c1C)N2 |
| InChI | InChI=1S/C20H18ClFN4O2/c1-11-18-20(26-25-11)23-16-10-17(28-8-7-27-2)15(22)9-13(16)19(24-18)12-5-3-4-6-14(12)21/h3-6,9-10H,7-8H2,1-2H3,(H2,23,25,26) |
| InChIKey | BFKPJYDGKBNAQF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|