C34H26N4O2 — CID 135503060
5,15-bis(3-methoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 135503060) has the molecular formula C34H26N4O2 and a molecular weight of 522.61 g/mol. Its IUPAC name is 5,15-bis(3-methoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(3-methoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135503060 |
| Molecular Formula | C34H26N4O2 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 5,15-bis(3-methoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1cccc(-c2c3nc(cc4ccc([nH]4)c(-c4cccc(OC)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C34H26N4O2/c1-39-27-7-3-5-21(17-27)33-29-13-9-23(35-29)19-25-11-15-31(37-25)34(22-6-4-8-28(18-22)40-2)32-16-12-26(38-32)20-24-10-14-30(33)36-24/h3-20,35,38H,1-2H3/b23-19-,24-20-,25-19-,26-20-,33-29-,33-30-,34-31-,34-32- |
| InChIKey | CJHZLOAXCHMJNU-QXMHVHRDSA-N |
| XLogP | 8.01 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |