About 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine
7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine (PubChem CID 135503520) has the molecular formula C16H21N5
and a molecular weight of 283.38 g/mol. Its IUPAC name is 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine.
Molecular Properties
| Compound Name | 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine |
| PubChem CID | 135503520 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine |
| SMILES | [H]/N=C1\c2cn[nH]c2N(C(C)(C)C)CN1c1ccc(C)cc1 |
| InChI | InChI=1S/C16H21N5/c1-11-5-7-12(8-6-11)20-10-21(16(2,3)4)15-13(14(20)17)9-18-19-15/h5-9,17H,10H2,1-4H3,(H,18,19)/b17-14+ |
| InChIKey | FIUGIHSMYBTREC-SAPNQHFASA-N |
| XLogP | 3.13 |
| TPSA | 59.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine?
The IUPAC name of 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine (CID 135503520) is 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine.
What is the SMILES notation for 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine?
The canonical SMILES for 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine is [H]/N=C1\c2cn[nH]c2N(C(C)(C)C)CN1c1ccc(C)cc1.
What is the InChIKey of 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine?
The InChIKey is FIUGIHSMYBTREC-SAPNQHFASA-N. The full InChI is InChI=1S/C16H21N5/c1-11-5-7-12(8-6-11)20-10-21(16(2,3)4)15-13(14(20)17)9-18-19-15/h5-9,17H,10H2,1-4H3,(H,18,19)/b17-14+.
What are the key properties of 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine?
7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine has a molecular weight of 283.38 g/mol, XLogP of 3.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-5-(4-methylphenyl)-1,6-dihydropyrazolo[5,4-d]pyrimidin-4-imine is sourced from PubChem (CID 135503520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).