About CID 135503775
CID 135503775 (PubChem CID 135503775) has the molecular formula C22H16F2N2NaO2
and a molecular weight of 401.37 g/mol.
Molecular Properties
| Compound Name | CID 135503775 |
| PubChem CID | 135503775 |
| Molecular Formula | C22H16F2N2NaO2 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | — |
| SMILES | O=c1c2cc(F)ccc2nc(-c2ccccc2O)n1CCc1cccc(F)c1.[Na] |
| InChI | InChI=1S/C22H16F2N2O2.Na/c23-15-5-3-4-14(12-15)10-11-26-21(17-6-1-2-7-20(17)27)25-19-9-8-16(24)13-18(19)22(26)28;/h1-9,12-13,27H,10-11H2; |
| InChIKey | VLDSQVGZZYOCIV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 135503775 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135503775?
The IUPAC name of CID 135503775 (CID 135503775) is not available.
What is the SMILES notation for CID 135503775?
The canonical SMILES for CID 135503775 is O=c1c2cc(F)ccc2nc(-c2ccccc2O)n1CCc1cccc(F)c1.[Na].
What is the InChIKey of CID 135503775?
The InChIKey is VLDSQVGZZYOCIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F2N2O2.Na/c23-15-5-3-4-14(12-15)10-11-26-21(17-6-1-2-7-20(17)27)25-19-9-8-16(24)13-18(19)22(26)28;/h1-9,12-13,27H,10-11H2;.
What are the key properties of CID 135503775?
CID 135503775 has a molecular weight of 401.37 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135503775 is sourced from PubChem (CID 135503775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).