C20H20FN3O4S — CID 135503985
ethyl (2Z)-4-ethyl-2-(2-fluorophenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate (PubChem CID 135503985) has the molecular formula C20H20FN3O4S and a molecular weight of 417.46 g/mol. Its IUPAC name is ethyl (2Z)-4-ethyl-2-(2-fluorophenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate.
| Compound Name | ethyl (2Z)-4-ethyl-2-(2-fluorophenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 135503985 |
| Molecular Formula | C20H20FN3O4S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | ethyl (2Z)-4-ethyl-2-(2-fluorophenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CC)Nc2ccccc2N/C1=N\S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C20H20FN3O4S/c1-3-14-18(20(25)28-4-2)19(23-16-11-7-6-10-15(16)22-14)24-29(26,27)17-12-8-5-9-13(17)21/h5-12,22H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | NUKKHFVVWVWLMN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|