C44H16Cl4F10N4 — CID 135504004
5,15-bis(2,6-dichlorophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin (PubChem CID 135504004) has the molecular formula C44H16Cl4F10N4 and a molecular weight of 932.43 g/mol. Its IUPAC name is 5,15-bis(2,6-dichlorophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(2,6-dichlorophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135504004 |
| Molecular Formula | C44H16Cl4F10N4 |
| Molecular Weight | 932.43 g/mol |
| Exact Mass | 930.00 |
| IUPAC Name | 5,15-bis(2,6-dichlorophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(c(-c4c(Cl)cccc4Cl)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(c(-c5c(Cl)cccc5Cl)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C44H16Cl4F10N4/c45-15-3-1-4-16(46)27(15)29-19-7-11-23(59-19)31(33-35(49)39(53)43(57)40(54)36(33)50)25-13-9-21(61-25)30(28-17(47)5-2-6-18(28)48)22-10-14-26(62-22)32(24-12-8-20(29)60-24)34-37(51)41(55)44(58)42(56)38(34)52/h1-14,59,62H/b29-19+,29-20+,30-21+,30-22+,31-23+,31-25+,32-24+,32-26+ |
| InChIKey | YJLPHTFHIWPERB-ZAASIZHMSA-N |
| XLogP | 15.33 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.43 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|