About 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol
4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 135504347) has the molecular formula C18H17N3O
and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol.
Molecular Properties
| Compound Name | 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol |
| PubChem CID | 135504347 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1ccc2cc(C)c(N/N=C/c3ccc(O)cc3)nc2c1 |
| InChI | InChI=1S/C18H17N3O/c1-12-3-6-15-10-13(2)18(20-17(15)9-12)21-19-11-14-4-7-16(22)8-5-14/h3-11,22H,1-2H3,(H,20,21)/b19-11+ |
| InChIKey | KNKNEAIJIQNANG-YBFXNURJSA-N |
| XLogP | 4.00 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol?
The IUPAC name of 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol (CID 135504347) is 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol.
What is the SMILES notation for 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol?
The canonical SMILES for 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol is Cc1ccc2cc(C)c(N/N=C/c3ccc(O)cc3)nc2c1.
What is the InChIKey of 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol?
The InChIKey is KNKNEAIJIQNANG-YBFXNURJSA-N. The full InChI is InChI=1S/C18H17N3O/c1-12-3-6-15-10-13(2)18(20-17(15)9-12)21-19-11-14-4-7-16(22)8-5-14/h3-11,22H,1-2H3,(H,20,21)/b19-11+.
What are the key properties of 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol?
4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol has a molecular weight of 291.35 g/mol, XLogP of 4.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-[(3,7-dimethylquinolin-2-yl)hydrazinylidene]methyl]phenol is sourced from PubChem (CID 135504347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).