About [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea
[(E)-(2,4-dihydroxyphenyl)methylideneamino]urea (PubChem CID 135504430) has the molecular formula C8H9N3O3
and a molecular weight of 195.18 g/mol. Its IUPAC name is [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea.
Molecular Properties
| Compound Name | [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea |
| PubChem CID | 135504430 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea |
| SMILES | NC(=O)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C8H9N3O3/c9-8(14)11-10-4-5-1-2-6(12)3-7(5)13/h1-4,12-13H,(H3,9,11,14)/b10-4+ |
| InChIKey | LDERFBFHRWDAHJ-ONNFQVAWSA-N |
| XLogP | 0.10 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea?
The IUPAC name of [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea (CID 135504430) is [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea.
What is the SMILES notation for [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea?
The canonical SMILES for [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea is NC(=O)N/N=C/c1ccc(O)cc1O.
What is the InChIKey of [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea?
The InChIKey is LDERFBFHRWDAHJ-ONNFQVAWSA-N. The full InChI is InChI=1S/C8H9N3O3/c9-8(14)11-10-4-5-1-2-6(12)3-7(5)13/h1-4,12-13H,(H3,9,11,14)/b10-4+.
What are the key properties of [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea?
[(E)-(2,4-dihydroxyphenyl)methylideneamino]urea has a molecular weight of 195.18 g/mol, XLogP of 0.10, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(2,4-dihydroxyphenyl)methylideneamino]urea is sourced from PubChem (CID 135504430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).