About methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate
methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate (PubChem CID 135504697) has the molecular formula C18H13Cl2N3O3
and a molecular weight of 390.23 g/mol. Its IUPAC name is methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate.
Molecular Properties
| Compound Name | methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate |
| PubChem CID | 135504697 |
| Molecular Formula | C18H13Cl2N3O3 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate |
| SMILES | [H]/N=C1\C(C#N)=C2C=C(O)C=C(C(=O)OC)C2(C)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl2N3O3/c1-18-12(6-10(24)7-13(18)17(25)26-2)11(8-21)16(22)23(18)9-3-4-14(19)15(20)5-9/h3-7,22,24H,1-2H3/b22-16+ |
| InChIKey | ANSHWCYZARILLL-CJLVFECKSA-N |
| XLogP | 3.92 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate?
The IUPAC name of methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate (CID 135504697) is methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate.
What is the SMILES notation for methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate?
The canonical SMILES for methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate is [H]/N=C1\C(C#N)=C2C=C(O)C=C(C(=O)OC)C2(C)N1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate?
The InChIKey is ANSHWCYZARILLL-CJLVFECKSA-N. The full InChI is InChI=1S/C18H13Cl2N3O3/c1-18-12(6-10(24)7-13(18)17(25)26-2)11(8-21)16(22)23(18)9-3-4-14(19)15(20)5-9/h3-7,22,24H,1-2H3/b22-16+.
What are the key properties of methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate?
methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate has a molecular weight of 390.23 g/mol, XLogP of 3.92, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-cyano-1-(3,4-dichlorophenyl)-5-hydroxy-2-imino-7a-methylindole-7-carboxylate is sourced from PubChem (CID 135504697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).