C29H22Cl2N4O4 — CID 135505356
4-chloro-N-[(E)-[5-[[3-[(E)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-4-hydroxyphenyl]methyl]-2-hydroxyphenyl]methylideneamino]benzamide (PubChem CID 135505356) has the molecular formula C29H22Cl2N4O4 and a molecular weight of 561.43 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[5-[[3-[(E)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-4-hydroxyphenyl]methyl]-2-hydroxyphenyl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-[5-[[3-[(E)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-4-hydroxyphenyl]methyl]-2-hydroxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135505356 |
| Molecular Formula | C29H22Cl2N4O4 |
| Molecular Weight | 561.43 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 4-chloro-N-[(E)-[5-[[3-[(E)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-4-hydroxyphenyl]methyl]-2-hydroxyphenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc(Cc2ccc(O)c(/C=N/NC(=O)c3ccc(Cl)cc3)c2)ccc1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H22Cl2N4O4/c30-24-7-3-20(4-8-24)28(38)34-32-16-22-14-18(1-11-26(22)36)13-19-2-12-27(37)23(15-19)17-33-35-29(39)21-5-9-25(31)10-6-21/h1-12,14-17,36-37H,13H2,(H,34,38)(H,35,39)/b32-16+,33-17+ |
| InChIKey | QIYJVUIMDQBUDH-CBLSGYJOSA-N |
| XLogP | 5.52 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.43 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|