C11H20N5O6P — CID 135505390
[(2R,3S,4R,5R)-5-(6-amino-2,3,7,8-tetrahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinic acid (PubChem CID 135505390) has the molecular formula C11H20N5O6P and a molecular weight of 349.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-2,3,7,8-tetrahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-2,3,7,8-tetrahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 135505390 |
| Molecular Formula | C11H20N5O6P |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-2,3,7,8-tetrahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OC[C@H]1O[C@@H](N2CNC3=C2NCN=C3N)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20N5O6P/c1-23(19,20)21-2-5-7(17)8(18)11(22-5)16-4-15-6-9(12)13-3-14-10(6)16/h5,7-8,11,14-15,17-18H,2-4H2,1H3,(H2,12,13)(H,19,20)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | KTAXISQYKSJJFC-IOSLPCCCSA-N |
| XLogP | -2.79 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|