C24H21FN4O3 — CID 135505661
2-amino-6-[5-(2-fluoro-4-methylanilino)-2-hydroxyphenyl]-N-(furan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 135505661) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-amino-6-[5-(2-fluoro-4-methylanilino)-2-hydroxyphenyl]-N-(furan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-amino-6-[5-(2-fluoro-4-methylanilino)-2-hydroxyphenyl]-N-(furan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135505661 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-amino-6-[5-(2-fluoro-4-methylanilino)-2-hydroxyphenyl]-N-(furan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(O)c(-c3ccc(C(=O)NCc4ccco4)c(N)n3)c2)c(F)c1 |
| InChI | InChI=1S/C24H21FN4O3/c1-14-4-7-21(19(25)11-14)28-15-5-9-22(30)18(12-15)20-8-6-17(23(26)29-20)24(31)27-13-16-3-2-10-32-16/h2-12,28,30H,13H2,1H3,(H2,26,29)(H,27,31) |
| InChIKey | OCXKTAWJOIYTKG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|