C16H20O2S — CID 135505756
4-hydroxy-3,5-dimethyl-5-[(2,4,6-trimethylphenyl)methyl]thiophen-2-one (PubChem CID 135505756) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethyl-5-[(2,4,6-trimethylphenyl)methyl]thiophen-2-one.
| Compound Name | 4-hydroxy-3,5-dimethyl-5-[(2,4,6-trimethylphenyl)methyl]thiophen-2-one |
|---|---|
| PubChem CID | 135505756 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-hydroxy-3,5-dimethyl-5-[(2,4,6-trimethylphenyl)methyl]thiophen-2-one |
| SMILES | CC1=C(O)C(C)(Cc2c(C)cc(C)cc2C)SC1=O |
| InChI | InChI=1S/C16H20O2S/c1-9-6-10(2)13(11(3)7-9)8-16(5)14(17)12(4)15(18)19-16/h6-7,17H,8H2,1-5H3 |
| InChIKey | DECFZFGYRJPNKA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|