C16H26N6O5 — CID 135505941
8-(6-aminohexylamino)-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135505941) has the molecular formula C16H26N6O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 8-(6-aminohexylamino)-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 8-(6-aminohexylamino)-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135505941 |
| Molecular Formula | C16H26N6O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 8-(6-aminohexylamino)-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | NCCCCCCNc1nc2c(=O)[nH]cnc2n1C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C16H26N6O5/c17-5-3-1-2-4-6-18-16-21-10-13(19-8-20-14(10)26)22(16)15-12(25)11(24)9(7-23)27-15/h8-9,11-12,15,23-25H,1-7,17H2,(H,18,21)(H,19,20,26) |
| InChIKey | LLZUUOCTFORBDZ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 171.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|