About 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine
1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine (PubChem CID 135506168) has the molecular formula C15H13N3S
and a molecular weight of 267.36 g/mol. Its IUPAC name is 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine.
Molecular Properties
| Compound Name | 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine |
| PubChem CID | 135506168 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine |
| SMILES | Cc1ccc2c(c1)Sc1cc3cnn(C)c3cc1N2 |
| InChI | InChI=1S/C15H13N3S/c1-9-3-4-11-14(5-9)19-15-6-10-8-16-18(2)13(10)7-12(15)17-11/h3-8,17H,1-2H3 |
| InChIKey | YVFGNMFYNQPTLO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine?
The IUPAC name of 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine (CID 135506168) is 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine.
What is the SMILES notation for 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine?
The canonical SMILES for 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine is Cc1ccc2c(c1)Sc1cc3cnn(C)c3cc1N2.
What is the InChIKey of 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine?
The InChIKey is YVFGNMFYNQPTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3S/c1-9-3-4-11-14(5-9)19-15-6-10-8-16-18(2)13(10)7-12(15)17-11/h3-8,17H,1-2H3.
What are the key properties of 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine?
1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine has a molecular weight of 267.36 g/mol, XLogP of 4.09, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethyl-10H-pyrazolo[3,4-b]phenothiazine is sourced from PubChem (CID 135506168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).