About 1-methyl-10H-pyrazolo[3,4-b]phenothiazine
1-methyl-10H-pyrazolo[3,4-b]phenothiazine (PubChem CID 135506169) has the molecular formula C14H11N3S
and a molecular weight of 253.33 g/mol. Its IUPAC name is 1-methyl-10H-pyrazolo[3,4-b]phenothiazine.
Molecular Properties
| Compound Name | 1-methyl-10H-pyrazolo[3,4-b]phenothiazine |
| PubChem CID | 135506169 |
| Molecular Formula | C14H11N3S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 1-methyl-10H-pyrazolo[3,4-b]phenothiazine |
| SMILES | Cn1ncc2cc3c(cc21)Nc1ccccc1S3 |
| InChI | InChI=1S/C14H11N3S/c1-17-12-7-11-14(6-9(12)8-15-17)18-13-5-3-2-4-10(13)16-11/h2-8,16H,1H3 |
| InChIKey | WENNVZFLMINNNJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-10H-pyrazolo[3,4-b]phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-10H-pyrazolo[3,4-b]phenothiazine?
The IUPAC name of 1-methyl-10H-pyrazolo[3,4-b]phenothiazine (CID 135506169) is 1-methyl-10H-pyrazolo[3,4-b]phenothiazine.
What is the SMILES notation for 1-methyl-10H-pyrazolo[3,4-b]phenothiazine?
The canonical SMILES for 1-methyl-10H-pyrazolo[3,4-b]phenothiazine is Cn1ncc2cc3c(cc21)Nc1ccccc1S3.
What is the InChIKey of 1-methyl-10H-pyrazolo[3,4-b]phenothiazine?
The InChIKey is WENNVZFLMINNNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3S/c1-17-12-7-11-14(6-9(12)8-15-17)18-13-5-3-2-4-10(13)16-11/h2-8,16H,1H3.
What are the key properties of 1-methyl-10H-pyrazolo[3,4-b]phenothiazine?
1-methyl-10H-pyrazolo[3,4-b]phenothiazine has a molecular weight of 253.33 g/mol, XLogP of 3.78, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-10H-pyrazolo[3,4-b]phenothiazine is sourced from PubChem (CID 135506169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).