C44H43N3O4 — CID 135506421
octyl 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate (PubChem CID 135506421) has the molecular formula C44H43N3O4 and a molecular weight of 677.85 g/mol. Its IUPAC name is octyl 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate.
| Compound Name | octyl 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
|---|---|
| PubChem CID | 135506421 |
| Molecular Formula | C44H43N3O4 |
| Molecular Weight | 677.85 g/mol |
| Exact Mass | 677.33 |
| IUPAC Name | octyl 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
| SMILES | CCCCCCCCOC(=O)C(C)Oc1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C44H43N3O4/c1-3-4-5-6-7-14-29-50-44(49)31(2)51-38-27-28-39(40(48)30-38)43-46-41(36-23-19-34(20-24-36)32-15-10-8-11-16-32)45-42(47-43)37-25-21-35(22-26-37)33-17-12-9-13-18-33/h8-13,15-28,30-31,48H,3-7,14,29H2,1-2H3 |
| InChIKey | TWCBCCIODCKPGX-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.85 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|