C23H34N6O7S — CID 135506889
(2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-[(4-oxo-3H-quinazolin-8-yl)sulfonylamino]butanediamide (PubChem CID 135506889) has the molecular formula C23H34N6O7S and a molecular weight of 538.63 g/mol. Its IUPAC name is (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-[(4-oxo-3H-quinazolin-8-yl)sulfonylamino]butanediamide.
| Compound Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-[(4-oxo-3H-quinazolin-8-yl)sulfonylamino]butanediamide |
|---|---|
| PubChem CID | 135506889 |
| Molecular Formula | C23H34N6O7S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-[(4-oxo-3H-quinazolin-8-yl)sulfonylamino]butanediamide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](NS(=O)(=O)c1cccc2c(=O)[nH]cnc12)C(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C23H34N6O7S/c1-12(2)10-14(20(31)27-18(22(33)24-6)23(3,4)5)17(21(32)28-34)29-37(35,36)15-9-7-8-13-16(15)25-11-26-19(13)30/h7-9,11-12,14,17-18,29,34H,10H2,1-6H3,(H,24,33)(H,27,31)(H,28,32)(H,25,26,30)/t14-,17+,18-/m1/s1 |
| InChIKey | WOGYYBSXXNJSRS-FHLIZLRMSA-N |
| XLogP | 0.01 |
| TPSA | 199.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|