C24H14Cl2N4O2S — CID 135507313
4-(2,6-dichlorophenyl)-11-ethoxy-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene-12-carbonitrile (PubChem CID 135507313) has the molecular formula C24H14Cl2N4O2S and a molecular weight of 493.38 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-11-ethoxy-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene-12-carbonitrile.
| Compound Name | 4-(2,6-dichlorophenyl)-11-ethoxy-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene-12-carbonitrile |
|---|---|
| PubChem CID | 135507313 |
| Molecular Formula | C24H14Cl2N4O2S |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-11-ethoxy-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene-12-carbonitrile |
| SMILES | CCOc1nc2sc3c(=O)[nH]c(-c4c(Cl)cccc4Cl)nc3c2c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C24H14Cl2N4O2S/c1-2-32-23-13(11-27)16(12-7-4-3-5-8-12)18-19-20(33-24(18)30-23)22(31)29-21(28-19)17-14(25)9-6-10-15(17)26/h3-10H,2H2,1H3,(H,28,29,31) |
| InChIKey | UGWQAPXSXVGBFY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |