C22H26BrN5O5S — CID 135507572
6-bromo-2-hydroxy-N-(2-methoxyethyl)-3-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-1H-indole-5-carboxamide (PubChem CID 135507572) has the molecular formula C22H26BrN5O5S and a molecular weight of 552.45 g/mol. Its IUPAC name is 6-bromo-2-hydroxy-N-(2-methoxyethyl)-3-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-1H-indole-5-carboxamide.
| Compound Name | 6-bromo-2-hydroxy-N-(2-methoxyethyl)-3-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 135507572 |
| Molecular Formula | C22H26BrN5O5S |
| Molecular Weight | 552.45 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 6-bromo-2-hydroxy-N-(2-methoxyethyl)-3-[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]-1H-indole-5-carboxamide |
| SMILES | COCCNC(=O)c1cc2c(-c3ccc(S(=O)(=O)N4CCN(C)CC4)cn3)c(O)[nH]c2cc1Br |
| InChI | InChI=1S/C22H26BrN5O5S/c1-27-6-8-28(9-7-27)34(31,32)14-3-4-18(25-13-14)20-16-11-15(21(29)24-5-10-33-2)17(23)12-19(16)26-22(20)30/h3-4,11-13,26,30H,5-10H2,1-2H3,(H,24,29) |
| InChIKey | CFYBYUOWAYHPLW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|