C33H34N4O5 — CID 135507700
methyl 3-[(8Z)-8-(hydroxymethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoate (PubChem CID 135507700) has the molecular formula C33H34N4O5 and a molecular weight of 566.66 g/mol. Its IUPAC name is methyl 3-[(8Z)-8-(hydroxymethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[(8Z)-8-(hydroxymethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 135507700 |
| Molecular Formula | C33H34N4O5 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | methyl 3-[(8Z)-8-(hydroxymethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)/C2=C/C3=C(C)/C(=C/O)C(=N3)/C=c3\[nH]/c(cc3C)=C\C3=N/C(=C\C1=N2)C(CCC(=O)OC)=C3C |
| InChI | InChI=1S/C33H34N4O5/c1-17-11-21-12-26-18(2)22(7-9-32(39)41-5)29(35-26)15-30-23(8-10-33(40)42-6)19(3)27(36-30)14-28-20(4)24(16-38)31(37-28)13-25(17)34-21/h11-16,34,38H,7-10H2,1-6H3/b21-12-,24-16-,25-13-,27-14-,29-15- |
| InChIKey | HRXKIGMBGZXFJI-FATPFGONSA-N |
| XLogP | 4.28 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|