C33H48N3O5S+ — CID 135507704
N,N-dicyclohexyl-1-[(1S,2R,4R)-2-[(4R,6R)-3-(iminomethylidene)-2-oxo-4-phenyloxazinan-2-ium-6-yl]oxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide (PubChem CID 135507704) has the molecular formula C33H48N3O5S+ and a molecular weight of 598.83 g/mol. Its IUPAC name is N,N-dicyclohexyl-1-[(1S,2R,4R)-2-[(4R,6R)-3-(iminomethylidene)-2-oxo-4-phenyloxazinan-2-ium-6-yl]oxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide.
| Compound Name | N,N-dicyclohexyl-1-[(1S,2R,4R)-2-[(4R,6R)-3-(iminomethylidene)-2-oxo-4-phenyloxazinan-2-ium-6-yl]oxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
|---|---|
| PubChem CID | 135507704 |
| Molecular Formula | C33H48N3O5S+ |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | N,N-dicyclohexyl-1-[(1S,2R,4R)-2-[(4R,6R)-3-(iminomethylidene)-2-oxo-4-phenyloxazinan-2-ium-6-yl]oxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](O[C@H]1C[C@H](c3ccccc3)C(=C=N)[N+](=O)O1)C2 |
| InChI | InChI=1S/C33H48N3O5S/c1-32(2)25-18-19-33(32,23-42(38,39)35(26-14-8-4-9-15-26)27-16-10-5-11-17-27)30(20-25)40-31-21-28(24-12-6-3-7-13-24)29(22-34)36(37)41-31/h3,6-7,12-13,25-28,30-31,34H,4-5,8-11,14-21,23H2,1-2H3/q+1/t25-,28-,30-,31-,33-/m1/s1 |
| InChIKey | KXOCQVYCJVTQTD-KEKZQYKISA-N |
| XLogP | 6.85 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|