C8H8FN3O2S — CID 135507769
7-fluoro-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135507769) has the molecular formula C8H8FN3O2S and a molecular weight of 229.24 g/mol. Its IUPAC name is 7-fluoro-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 7-fluoro-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135507769 |
| Molecular Formula | C8H8FN3O2S |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 7-fluoro-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | C/N=C1\Nc2ccc(F)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C8H8FN3O2S/c1-10-8-11-6-3-2-5(9)4-7(6)15(13,14)12-8/h2-4H,1H3,(H2,10,11,12) |
| InChIKey | PJHFBLBJDHHHNR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|