C47H36N4O3 — CID 135508181
5,10,15-triphenyl-20-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 135508181) has the molecular formula C47H36N4O3 and a molecular weight of 704.83 g/mol. Its IUPAC name is 5,10,15-triphenyl-20-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-triphenyl-20-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135508181 |
| Molecular Formula | C47H36N4O3 |
| Molecular Weight | 704.83 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | 5,10,15-triphenyl-20-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1cc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc(OC)c1OC |
| InChI | InChI=1S/C47H36N4O3/c1-52-41-27-32(28-42(53-2)47(41)54-3)46-39-25-23-37(50-39)44(30-15-9-5-10-16-30)35-21-19-33(48-35)43(29-13-7-4-8-14-29)34-20-22-36(49-34)45(31-17-11-6-12-18-31)38-24-26-40(46)51-38/h4-28,48,51H,1-3H3/b43-33-,43-34-,44-35-,44-37-,45-36-,45-38-,46-39-,46-40- |
| InChIKey | LXAQZFGQLWDGHU-ZOQYUPKHSA-N |
| XLogP | 11.35 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.83 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |