C18H20N4S — CID 135508250
5-cyclopentyl-N-methyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine (PubChem CID 135508250) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is 5-cyclopentyl-N-methyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine.
| Compound Name | 5-cyclopentyl-N-methyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
|---|---|
| PubChem CID | 135508250 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 5-cyclopentyl-N-methyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
| SMILES | C/N=C1\Nc2ncccc2C(C2CCCC2)=NC1c1cccs1 |
| InChI | InChI=1S/C18H20N4S/c1-19-18-16(14-9-5-11-23-14)21-15(12-6-2-3-7-12)13-8-4-10-20-17(13)22-18/h4-5,8-12,16H,2-3,6-7H2,1H3,(H,19,20,22) |
| InChIKey | QUTZZTQEHSJLRN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|