About 2-amino-8-methyl-3H-pteridine-4,7-dione
2-amino-8-methyl-3H-pteridine-4,7-dione (PubChem CID 135508303) has the molecular formula C7H7N5O2
and a molecular weight of 193.17 g/mol. Its IUPAC name is 2-amino-8-methyl-3H-pteridine-4,7-dione.
Molecular Properties
| Compound Name | 2-amino-8-methyl-3H-pteridine-4,7-dione |
| PubChem CID | 135508303 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-amino-8-methyl-3H-pteridine-4,7-dione |
| SMILES | Cn1c(=O)cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C7H7N5O2/c1-12-3(13)2-9-4-5(12)10-7(8)11-6(4)14/h2H,1H3,(H3,8,10,11,14) |
| InChIKey | SLNSAAHOIROZOZ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-8-methyl-3H-pteridine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-methyl-3H-pteridine-4,7-dione?
The IUPAC name of 2-amino-8-methyl-3H-pteridine-4,7-dione (CID 135508303) is 2-amino-8-methyl-3H-pteridine-4,7-dione.
What is the SMILES notation for 2-amino-8-methyl-3H-pteridine-4,7-dione?
The canonical SMILES for 2-amino-8-methyl-3H-pteridine-4,7-dione is Cn1c(=O)cnc2c(=O)[nH]c(N)nc21.
What is the InChIKey of 2-amino-8-methyl-3H-pteridine-4,7-dione?
The InChIKey is SLNSAAHOIROZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O2/c1-12-3(13)2-9-4-5(12)10-7(8)11-6(4)14/h2H,1H3,(H3,8,10,11,14).
What are the key properties of 2-amino-8-methyl-3H-pteridine-4,7-dione?
2-amino-8-methyl-3H-pteridine-4,7-dione has a molecular weight of 193.17 g/mol, XLogP of -1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-methyl-3H-pteridine-4,7-dione is sourced from PubChem (CID 135508303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).