About 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol
6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol (PubChem CID 135508764) has the molecular formula C17H18N4O
and a molecular weight of 294.36 g/mol. Its IUPAC name is 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol.
Molecular Properties
| Compound Name | 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol |
| PubChem CID | 135508764 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol |
| SMILES | Oc1ccc2c(c1)N=C(N1CCNCC1)c1ccccc1N2 |
| InChI | InChI=1S/C17H18N4O/c22-12-5-6-15-16(11-12)20-17(21-9-7-18-8-10-21)13-3-1-2-4-14(13)19-15/h1-6,11,18-19,22H,7-10H2 |
| InChIKey | SDLNSKFYCGPTMW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol?
The IUPAC name of 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol (CID 135508764) is 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol.
What is the SMILES notation for 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol?
The canonical SMILES for 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol is Oc1ccc2c(c1)N=C(N1CCNCC1)c1ccccc1N2.
What is the InChIKey of 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol?
The InChIKey is SDLNSKFYCGPTMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O/c22-12-5-6-15-16(11-12)20-17(21-9-7-18-8-10-21)13-3-1-2-4-14(13)19-15/h1-6,11,18-19,22H,7-10H2.
What are the key properties of 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol?
6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol has a molecular weight of 294.36 g/mol, XLogP of 2.43, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepin-3-ol is sourced from PubChem (CID 135508764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).