C8H10N4O4S — CID 135508874
5-amino-3-(2-hydroxyethoxymethyl)-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione (PubChem CID 135508874) has the molecular formula C8H10N4O4S and a molecular weight of 258.26 g/mol. Its IUPAC name is 5-amino-3-(2-hydroxyethoxymethyl)-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 5-amino-3-(2-hydroxyethoxymethyl)-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 135508874 |
| Molecular Formula | C8H10N4O4S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 5-amino-3-(2-hydroxyethoxymethyl)-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
| SMILES | Nc1nc2c(sc(=O)n2COCCO)c(=O)[nH]1 |
| InChI | InChI=1S/C8H10N4O4S/c9-7-10-5-4(6(14)11-7)17-8(15)12(5)3-16-2-1-13/h13H,1-3H2,(H3,9,10,11,14) |
| InChIKey | NSGDRUPUQOPKHY-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|