About N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide
N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide (PubChem CID 135509065) has the molecular formula C16H15N3O3S
and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide.
Molecular Properties
| Compound Name | N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide |
| PubChem CID | 135509065 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide |
| SMILES | O=C(NCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C16H15N3O3S/c20-16(12-6-2-1-3-7-12)18-11-10-17-15-13-8-4-5-9-14(13)23(21,22)19-15/h1-9H,10-11H2,(H,17,19)(H,18,20) |
| InChIKey | BWEIWLIAMRKMTG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide?
The IUPAC name of N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide (CID 135509065) is N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide.
What is the SMILES notation for N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide?
The canonical SMILES for N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide is O=C(NCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1.
What is the InChIKey of N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide?
The InChIKey is BWEIWLIAMRKMTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3S/c20-16(12-6-2-1-3-7-12)18-11-10-17-15-13-8-4-5-9-14(13)23(21,22)19-15/h1-9H,10-11H2,(H,17,19)(H,18,20).
What are the key properties of N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide?
N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide has a molecular weight of 329.38 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]benzamide is sourced from PubChem (CID 135509065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).