C8H9N5O3 — CID 135509077
(6aR)-3-amino-5,6,6a,7-tetrahydro-2H-[1,3]oxazolo[3,4-f]pteridine-1,9-dione (PubChem CID 135509077) has the molecular formula C8H9N5O3 and a molecular weight of 223.19 g/mol. Its IUPAC name is (6aR)-3-amino-5,6,6a,7-tetrahydro-2H-[1,3]oxazolo[3,4-f]pteridine-1,9-dione.
| Compound Name | (6aR)-3-amino-5,6,6a,7-tetrahydro-2H-[1,3]oxazolo[3,4-f]pteridine-1,9-dione |
|---|---|
| PubChem CID | 135509077 |
| Molecular Formula | C8H9N5O3 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (6aR)-3-amino-5,6,6a,7-tetrahydro-2H-[1,3]oxazolo[3,4-f]pteridine-1,9-dione |
| SMILES | Nc1nc2c(c(=O)[nH]1)N1C(=O)OC[C@H]1CN2 |
| InChI | InChI=1S/C8H9N5O3/c9-7-11-5-4(6(14)12-7)13-3(1-10-5)2-16-8(13)15/h3H,1-2H2,(H4,9,10,11,12,14)/t3-/m1/s1 |
| InChIKey | XAZOBOCYEGBXHD-GSVOUGTGSA-N |
| XLogP | -0.90 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |