About (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione
(2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione (PubChem CID 135509202) has the molecular formula C10H6N2O4
and a molecular weight of 218.17 g/mol. Its IUPAC name is (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione.
Molecular Properties
| Compound Name | (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione |
| PubChem CID | 135509202 |
| Molecular Formula | C10H6N2O4 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione |
| SMILES | O=c1/c(=N\O)c(=O)c2ccccc2/c1=N\O |
| InChI | InChI=1S/C10H6N2O4/c13-9-6-4-2-1-3-5(6)7(11-15)10(14)8(9)12-16/h1-4,15-16H/b11-7+,12-8- |
| InChIKey | TVUCGHFNVJEZDY-RLCSYUECSA-N |
| XLogP | -0.98 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione?
The IUPAC name of (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione (CID 135509202) is (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione.
What is the SMILES notation for (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione?
The canonical SMILES for (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione is O=c1/c(=N\O)c(=O)c2ccccc2/c1=N\O.
What is the InChIKey of (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione?
The InChIKey is TVUCGHFNVJEZDY-RLCSYUECSA-N. The full InChI is InChI=1S/C10H6N2O4/c13-9-6-4-2-1-3-5(6)7(11-15)10(14)8(9)12-16/h1-4,15-16H/b11-7+,12-8-.
What are the key properties of (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione?
(2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione has a molecular weight of 218.17 g/mol, XLogP of -0.98, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-2,4-bis(hydroxyimino)naphthalene-1,3-dione is sourced from PubChem (CID 135509202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).